About naphthalen-1-yl pentyl carbonate
naphthalen-1-yl pentyl carbonate (PubChem CID 175011067) has the molecular formula C16H18O3
and a molecular weight of 258.32 g/mol. Its IUPAC name is naphthalen-1-yl pentyl carbonate.
Molecular Properties
| Compound Name | naphthalen-1-yl pentyl carbonate |
| PubChem CID | 175011067 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | naphthalen-1-yl pentyl carbonate |
| SMILES | CCCCCOC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C16H18O3/c1-2-3-6-12-18-16(17)19-15-11-7-9-13-8-4-5-10-14(13)15/h4-5,7-11H,2-3,6,12H2,1H3 |
| InChIKey | OWZBIAZWCDKSCG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-yl pentyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-yl pentyl carbonate?
The IUPAC name of naphthalen-1-yl pentyl carbonate (CID 175011067) is naphthalen-1-yl pentyl carbonate.
What is the SMILES notation for naphthalen-1-yl pentyl carbonate?
The canonical SMILES for naphthalen-1-yl pentyl carbonate is CCCCCOC(=O)Oc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-yl pentyl carbonate?
The InChIKey is OWZBIAZWCDKSCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O3/c1-2-3-6-12-18-16(17)19-15-11-7-9-13-8-4-5-10-14(13)15/h4-5,7-11H,2-3,6,12H2,1H3.
What are the key properties of naphthalen-1-yl pentyl carbonate?
naphthalen-1-yl pentyl carbonate has a molecular weight of 258.32 g/mol, XLogP of 4.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-yl pentyl carbonate is sourced from PubChem (CID 175011067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).