C52H60O12 — CID 135239801
(10-butoxycarbonyloxy-1,5-dimethylanthracen-9-yl) butyl carbonate;[1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate (PubChem CID 135239801) has the molecular formula C52H60O12 and a molecular weight of 877.04 g/mol. Its IUPAC name is (10-butoxycarbonyloxy-1,5-dimethylanthracen-9-yl) butyl carbonate;[1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate.
| Compound Name | (10-butoxycarbonyloxy-1,5-dimethylanthracen-9-yl) butyl carbonate;[1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 135239801 |
| Molecular Formula | C52H60O12 |
| Molecular Weight | 877.04 g/mol |
| Exact Mass | 876.41 |
| IUPAC Name | (10-butoxycarbonyloxy-1,5-dimethylanthracen-9-yl) butyl carbonate;[1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate |
| SMILES | CCCCOC(=O)Oc1c2cccc(C)c2c(OC(=O)OCCCC)c2cccc(C)c12.Cc1cccc2c(OC(=O)OCC(C)C)c3c(C)cccc3c(OC(=O)OCC(C)C)c12 |
| InChI | InChI=1S/2C26H30O6/c1-15(2)13-29-25(27)31-23-19-11-7-10-18(6)22(19)24(32-26(28)30-14-16(3)4)20-12-8-9-17(5)21(20)23;1-5-7-15-29-25(27)31-23-19-13-9-12-18(4)22(19)24(32-26(28)30-16-8-6-2)20-14-10-11-17(3)21(20)23/h7-12,15-16H,13-14H2,1-6H3;9-14H,5-8,15-16H2,1-4H3 |
| InChIKey | VWFQIHYTHUGCSV-UHFFFAOYSA-N |
| XLogP | 14.19 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.04 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|