C26H30O6 — CID 135239802
[1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate (PubChem CID 135239802) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is [1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate.
| Compound Name | [1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 135239802 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [1,5-dimethyl-10-(2-methylpropoxycarbonyloxy)anthracen-9-yl] 2-methylpropyl carbonate |
| SMILES | Cc1cccc2c(OC(=O)OCC(C)C)c3c(C)cccc3c(OC(=O)OCC(C)C)c12 |
| InChI | InChI=1S/C26H30O6/c1-15(2)13-29-25(27)31-23-19-11-7-10-18(6)22(19)24(32-26(28)30-14-16(3)4)20-12-8-9-17(5)21(20)23/h7-12,15-16H,13-14H2,1-6H3 |
| InChIKey | CWSABCBQWAHYGZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|