C21H24O3 — CID 18515031
2-methylpropyl 3-(2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate (PubChem CID 18515031) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-methylpropyl 3-(2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate.
| Compound Name | 2-methylpropyl 3-(2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 18515031 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-methylpropyl 3-(2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate |
| SMILES | Cc1cccc(C)c1C(=O)C(C(=O)OCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H24O3/c1-14(2)13-24-21(23)19(17-11-6-5-7-12-17)20(22)18-15(3)9-8-10-16(18)4/h5-12,14,19H,13H2,1-4H3 |
| InChIKey | QSUCPQFQPNSOSW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|