C20H25O3P — CID 157104777
methyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propanoate;phosphane (PubChem CID 157104777) has the molecular formula C20H25O3P and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propanoate;phosphane.
| Compound Name | methyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propanoate;phosphane |
|---|---|
| PubChem CID | 157104777 |
| Molecular Formula | C20H25O3P |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | methyl 3-oxo-2-phenyl-3-(2,3,4,6-tetramethylphenyl)propanoate;phosphane |
| SMILES | COC(=O)C(C(=O)c1c(C)cc(C)c(C)c1C)c1ccccc1.P |
| InChI | InChI=1S/C20H22O3.H3P/c1-12-11-13(2)17(15(4)14(12)3)19(21)18(20(22)23-5)16-9-7-6-8-10-16;/h6-11,18H,1-5H3;1H3 |
| InChIKey | AGEGGNRUFUJQRU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|