C25H34O4P+ — CID 160851565
butyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium (PubChem CID 160851565) has the molecular formula C25H34O4P+ and a molecular weight of 429.52 g/mol. Its IUPAC name is butyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium.
| Compound Name | butyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
|---|---|
| PubChem CID | 160851565 |
| Molecular Formula | C25H34O4P+ |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | butyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate;oxophosphanium |
| SMILES | CCCCOC(=O)C(C(=O)c1c(C)cc(C(C)(C)C)cc1C)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C25H32O3.H2OP/c1-7-8-14-28-24(27)22(19-12-10-9-11-13-19)23(26)21-17(2)15-20(16-18(21)3)25(4,5)6;1-2/h9-13,15-16,22H,7-8,14H2,1-6H3;2H2/q;+1 |
| InChIKey | NNFIYXGTTCJJKS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|