C26H36O4P+ — CID 161323163
oxophosphanium;2,4,4-trimethylpentyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate (PubChem CID 161323163) has the molecular formula C26H36O4P+ and a molecular weight of 443.54 g/mol. Its IUPAC name is oxophosphanium;2,4,4-trimethylpentyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate.
| Compound Name | oxophosphanium;2,4,4-trimethylpentyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate |
|---|---|
| PubChem CID | 161323163 |
| Molecular Formula | C26H36O4P+ |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | oxophosphanium;2,4,4-trimethylpentyl 3-oxo-2-phenyl-3-(2,4,6-trimethylphenyl)propanoate |
| SMILES | Cc1cc(C)c(C(=O)C(C(=O)OCC(C)CC(C)(C)C)c2ccccc2)c(C)c1.O=[PH2+] |
| InChI | InChI=1S/C26H34O3.H2OP/c1-17-13-19(3)22(20(4)14-17)24(27)23(21-11-9-8-10-12-21)25(28)29-16-18(2)15-26(5,6)7;1-2/h8-14,18,23H,15-16H2,1-7H3;2H2/q;+1 |
| InChIKey | SWFIBNRTUCSJGW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|