C29H40O3 — CID 18515291
2,4,4-trimethylpentyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate (PubChem CID 18515291) has the molecular formula C29H40O3 and a molecular weight of 436.64 g/mol. Its IUPAC name is 2,4,4-trimethylpentyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate.
| Compound Name | 2,4,4-trimethylpentyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 18515291 |
| Molecular Formula | C29H40O3 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 2,4,4-trimethylpentyl 3-(4-tert-butyl-2,6-dimethylphenyl)-3-oxo-2-phenylpropanoate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)C(C(=O)OCC(C)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H40O3/c1-19(17-28(4,5)6)18-32-27(31)25(22-13-11-10-12-14-22)26(30)24-20(2)15-23(16-21(24)3)29(7,8)9/h10-16,19,25H,17-18H2,1-9H3 |
| InChIKey | IHMARNVHEYCPKW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|