C25H34O6P+ — CID 158116368
oxophosphanium;2,4,4-trimethylpentyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate (PubChem CID 158116368) has the molecular formula C25H34O6P+ and a molecular weight of 461.52 g/mol. Its IUPAC name is oxophosphanium;2,4,4-trimethylpentyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate.
| Compound Name | oxophosphanium;2,4,4-trimethylpentyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 158116368 |
| Molecular Formula | C25H34O6P+ |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | oxophosphanium;2,4,4-trimethylpentyl 3-(2,6-dimethoxyphenyl)-3-oxo-2-phenylpropanoate |
| SMILES | COc1cccc(OC)c1C(=O)C(C(=O)OCC(C)CC(C)(C)C)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C25H32O5.H2OP/c1-17(15-25(2,3)4)16-30-24(27)21(18-11-8-7-9-12-18)23(26)22-19(28-5)13-10-14-20(22)29-6;1-2/h7-14,17,21H,15-16H2,1-6H3;2H2/q;+1 |
| InChIKey | AUNDXCJBSIVLGW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|