C23H38O6P+ — CID 160617997
2-methylpropyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate;oxophosphanium (PubChem CID 160617997) has the molecular formula C23H38O6P+ and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-methylpropyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate;oxophosphanium.
| Compound Name | 2-methylpropyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate;oxophosphanium |
|---|---|
| PubChem CID | 160617997 |
| Molecular Formula | C23H38O6P+ |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-methylpropyl 2-(2,6-dimethoxybenzoyl)-4,6,6-trimethylheptanoate;oxophosphanium |
| SMILES | COc1cccc(OC)c1C(=O)C(CC(C)CC(C)(C)C)C(=O)OCC(C)C.O=[PH2+] |
| InChI | InChI=1S/C23H36O5.H2OP/c1-15(2)14-28-22(25)17(12-16(3)13-23(4,5)6)21(24)20-18(26-7)10-9-11-19(20)27-8;1-2/h9-11,15-17H,12-14H2,1-8H3;2H2/q;+1 |
| InChIKey | RYSACPAYTRQOAO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|