C26H37O11P — CID 69203582
[2-(2,6-dimethoxybenzoyl)-1-(2,6-dimethoxyphenyl)-3,5,5-trimethyl-1-oxohexan-2-yl] dihydrogen phosphate;hydrate (PubChem CID 69203582) has the molecular formula C26H37O11P and a molecular weight of 556.55 g/mol. Its IUPAC name is [2-(2,6-dimethoxybenzoyl)-1-(2,6-dimethoxyphenyl)-3,5,5-trimethyl-1-oxohexan-2-yl] dihydrogen phosphate;hydrate.
| Compound Name | [2-(2,6-dimethoxybenzoyl)-1-(2,6-dimethoxyphenyl)-3,5,5-trimethyl-1-oxohexan-2-yl] dihydrogen phosphate;hydrate |
|---|---|
| PubChem CID | 69203582 |
| Molecular Formula | C26H37O11P |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | [2-(2,6-dimethoxybenzoyl)-1-(2,6-dimethoxyphenyl)-3,5,5-trimethyl-1-oxohexan-2-yl] dihydrogen phosphate;hydrate |
| SMILES | COc1cccc(OC)c1C(=O)C(OP(=O)(O)O)(C(=O)c1c(OC)cccc1OC)C(C)CC(C)(C)C.O |
| InChI | InChI=1S/C26H35O10P.H2O/c1-16(15-25(2,3)4)26(36-37(29,30)31,23(27)21-17(32-5)11-9-12-18(21)33-6)24(28)22-19(34-7)13-10-14-20(22)35-8;/h9-14,16H,15H2,1-8H3,(H2,29,30,31);1H2 |
| InChIKey | RPDVIHCXSOTMTL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|