C26H37O7P — CID 146450949
(2,6-dimethoxybenzoyl) 2,6-dimethoxybenzoate;2,4,4-trimethylpentylphosphane (PubChem CID 146450949) has the molecular formula C26H37O7P and a molecular weight of 492.55 g/mol. Its IUPAC name is (2,6-dimethoxybenzoyl) 2,6-dimethoxybenzoate;2,4,4-trimethylpentylphosphane.
| Compound Name | (2,6-dimethoxybenzoyl) 2,6-dimethoxybenzoate;2,4,4-trimethylpentylphosphane |
|---|---|
| PubChem CID | 146450949 |
| Molecular Formula | C26H37O7P |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | (2,6-dimethoxybenzoyl) 2,6-dimethoxybenzoate;2,4,4-trimethylpentylphosphane |
| SMILES | CC(CP)CC(C)(C)C.COc1cccc(OC)c1C(=O)OC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C18H18O7.C8H19P/c1-21-11-7-5-8-12(22-2)15(11)17(19)25-18(20)16-13(23-3)9-6-10-14(16)24-4;1-7(6-9)5-8(2,3)4/h5-10H,1-4H3;7H,5-6,9H2,1-4H3 |
| InChIKey | TVTLXJPWLFHWQR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|