C18H29LiO4P — CID 162326255
CID 162326255 (PubChem CID 162326255) has the molecular formula C18H29LiO4P and a molecular weight of 347.34 g/mol.
| Compound Name | CID 162326255 |
|---|---|
| PubChem CID | 162326255 |
| Molecular Formula | C18H29LiO4P |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | — |
| SMILES | COc1ccc(OC)c(C(=O)PCC(C)CC(C)(C)C)c1OC.[Li] |
| InChI | InChI=1S/C18H29O4P.Li/c1-12(10-18(2,3)4)11-23-17(19)15-13(20-5)8-9-14(21-6)16(15)22-7;/h8-9,12,23H,10-11H2,1-7H3; |
| InChIKey | PDDLYRIVXBJSPU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|