C16H22Cl2LiO2P — CID 141022766
lithium (3,6-dichloro-2-methoxybenzoyl)-(2,4,4-trimethylpentyl)phosphanide (PubChem CID 141022766) has the molecular formula C16H22Cl2LiO2P and a molecular weight of 355.17 g/mol. Its IUPAC name is lithium (3,6-dichloro-2-methoxybenzoyl)-(2,4,4-trimethylpentyl)phosphanide.
| Compound Name | lithium (3,6-dichloro-2-methoxybenzoyl)-(2,4,4-trimethylpentyl)phosphanide |
|---|---|
| PubChem CID | 141022766 |
| Molecular Formula | C16H22Cl2LiO2P |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | lithium (3,6-dichloro-2-methoxybenzoyl)-(2,4,4-trimethylpentyl)phosphanide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)[P-]CC(C)CC(C)(C)C.[Li+] |
| InChI | InChI=1S/C16H22Cl2O2P.Li/c1-10(8-16(2,3)4)9-21-15(19)13-11(17)6-7-12(18)14(13)20-5;/h6-7,10H,8-9H2,1-5H3;/q-1;+1 |
| InChIKey | PSYMKBRCDIPCAD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|