C11H13Cl2NO3 — CID 110287800
3,6-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-2-methoxybenzamide (PubChem CID 110287800) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. Its IUPAC name is 3,6-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-2-methoxybenzamide.
| Compound Name | 3,6-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 110287800 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 3,6-dichloro-N-[(2S)-1-hydroxypropan-2-yl]-2-methoxybenzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C11H13Cl2NO3/c1-6(5-15)14-11(16)9-7(12)3-4-8(13)10(9)17-2/h3-4,6,15H,5H2,1-2H3,(H,14,16)/t6-/m0/s1 |
| InChIKey | KOOXLLMTTYRRDI-LURJTMIESA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |