C16H22Cl2N2O5 — CID 88519708
[di(propan-2-yl)amino] 2-[(3,6-dichloro-2-methoxybenzoyl)amino]oxyacetate (PubChem CID 88519708) has the molecular formula C16H22Cl2N2O5 and a molecular weight of 393.27 g/mol. Its IUPAC name is [di(propan-2-yl)amino] 2-[(3,6-dichloro-2-methoxybenzoyl)amino]oxyacetate.
| Compound Name | [di(propan-2-yl)amino] 2-[(3,6-dichloro-2-methoxybenzoyl)amino]oxyacetate |
|---|---|
| PubChem CID | 88519708 |
| Molecular Formula | C16H22Cl2N2O5 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [di(propan-2-yl)amino] 2-[(3,6-dichloro-2-methoxybenzoyl)amino]oxyacetate |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)NOCC(=O)ON(C(C)C)C(C)C |
| InChI | InChI=1S/C16H22Cl2N2O5/c1-9(2)20(10(3)4)25-13(21)8-24-19-16(22)14-11(17)6-7-12(18)15(14)23-5/h6-7,9-10H,8H2,1-5H3,(H,19,22) |
| InChIKey | RCXCZWFHUNFONR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|