C8H9Cl2NO3 — CID 67127214
azanium 3,6-dichloro-2-methoxybenzoate (PubChem CID 67127214) has the molecular formula C8H9Cl2NO3 and a molecular weight of 238.07 g/mol. Its IUPAC name is azanium 3,6-dichloro-2-methoxybenzoate.
| Compound Name | azanium 3,6-dichloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 67127214 |
| Molecular Formula | C8H9Cl2NO3 |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | azanium 3,6-dichloro-2-methoxybenzoate |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)[O-].[NH4+] |
| InChI | InChI=1S/C8H6Cl2O3.H3N/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;/h2-3H,1H3,(H,11,12);1H3 |
| InChIKey | CLTYELOWSQOWDY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |