C14H10Cl2LiO2P — CID 141016757
lithium (3,6-dichloro-2-methoxybenzoyl)-phenylphosphanide (PubChem CID 141016757) has the molecular formula C14H10Cl2LiO2P and a molecular weight of 319.05 g/mol. Its IUPAC name is lithium (3,6-dichloro-2-methoxybenzoyl)-phenylphosphanide.
| Compound Name | lithium (3,6-dichloro-2-methoxybenzoyl)-phenylphosphanide |
|---|---|
| PubChem CID | 141016757 |
| Molecular Formula | C14H10Cl2LiO2P |
| Molecular Weight | 319.05 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | lithium (3,6-dichloro-2-methoxybenzoyl)-phenylphosphanide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)[P-]c1ccccc1.[Li+] |
| InChI | InChI=1S/C14H10Cl2O2P.Li/c1-18-13-11(16)8-7-10(15)12(13)14(17)19-9-5-3-2-4-6-9;/h2-8H,1H3;/q-1;+1 |
| InChIKey | YEHDEVXLUYJDQV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.05 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|