C16H15ClLiO2P — CID 141016761
lithium (2-chloro-6-methoxybenzoyl)-(2,6-dimethylphenyl)phosphanide (PubChem CID 141016761) has the molecular formula C16H15ClLiO2P and a molecular weight of 312.66 g/mol. Its IUPAC name is lithium (2-chloro-6-methoxybenzoyl)-(2,6-dimethylphenyl)phosphanide.
| Compound Name | lithium (2-chloro-6-methoxybenzoyl)-(2,6-dimethylphenyl)phosphanide |
|---|---|
| PubChem CID | 141016761 |
| Molecular Formula | C16H15ClLiO2P |
| Molecular Weight | 312.66 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | lithium (2-chloro-6-methoxybenzoyl)-(2,6-dimethylphenyl)phosphanide |
| SMILES | COc1cccc(Cl)c1C(=O)[P-]c1c(C)cccc1C.[Li+] |
| InChI | InChI=1S/C16H15ClO2P.Li/c1-10-6-4-7-11(2)15(10)20-16(18)14-12(17)8-5-9-13(14)19-3;/h4-9H,1-3H3;/q-1;+1 |
| InChIKey | APCPZQVWXPSWBB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.66 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|