C24H31ClLiO4P — CID 141016208
lithium (2-chloro-6-methoxybenzoyl)-(2,4-dipentoxyphenyl)phosphanide (PubChem CID 141016208) has the molecular formula C24H31ClLiO4P and a molecular weight of 456.88 g/mol. Its IUPAC name is lithium (2-chloro-6-methoxybenzoyl)-(2,4-dipentoxyphenyl)phosphanide.
| Compound Name | lithium (2-chloro-6-methoxybenzoyl)-(2,4-dipentoxyphenyl)phosphanide |
|---|---|
| PubChem CID | 141016208 |
| Molecular Formula | C24H31ClLiO4P |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | lithium (2-chloro-6-methoxybenzoyl)-(2,4-dipentoxyphenyl)phosphanide |
| SMILES | CCCCCOc1ccc([P-]C(=O)c2c(Cl)cccc2OC)c(OCCCCC)c1.[Li+] |
| InChI | InChI=1S/C24H31ClO4P.Li/c1-4-6-8-15-28-18-13-14-22(21(17-18)29-16-9-7-5-2)30-24(26)23-19(25)11-10-12-20(23)27-3;/h10-14,17H,4-9,15-16H2,1-3H3;/q-1;+1 |
| InChIKey | VWAVQIQJUAWNLR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|