C40H55O9P — CID 22717592
[(2,6-dimethoxybenzoyl)-(2,4-dioctoxyphenyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone (PubChem CID 22717592) has the molecular formula C40H55O9P and a molecular weight of 710.85 g/mol. Its IUPAC name is [(2,6-dimethoxybenzoyl)-(2,4-dioctoxyphenyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone.
| Compound Name | [(2,6-dimethoxybenzoyl)-(2,4-dioctoxyphenyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 22717592 |
| Molecular Formula | C40H55O9P |
| Molecular Weight | 710.85 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | [(2,6-dimethoxybenzoyl)-(2,4-dioctoxyphenyl)phosphoryl]-(2,6-dimethoxyphenyl)methanone |
| SMILES | CCCCCCCCOc1ccc(P(=O)(C(=O)c2c(OC)cccc2OC)C(=O)c2c(OC)cccc2OC)c(OCCCCCCCC)c1 |
| InChI | InChI=1S/C40H55O9P/c1-7-9-11-13-15-17-27-48-30-25-26-36(35(29-30)49-28-18-16-14-12-10-8-2)50(43,39(41)37-31(44-3)21-19-22-32(37)45-4)40(42)38-33(46-5)23-20-24-34(38)47-6/h19-26,29H,7-18,27-28H2,1-6H3 |
| InChIKey | DTEBKZFPSFBQQW-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.85 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|