C21H27O5P — CID 18514543
(2,6-dimethoxyphenyl)-(2,4-dipropoxyphenyl)phosphanylmethanone (PubChem CID 18514543) has the molecular formula C21H27O5P and a molecular weight of 390.42 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-(2,4-dipropoxyphenyl)phosphanylmethanone.
| Compound Name | (2,6-dimethoxyphenyl)-(2,4-dipropoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514543 |
| Molecular Formula | C21H27O5P |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (2,6-dimethoxyphenyl)-(2,4-dipropoxyphenyl)phosphanylmethanone |
| SMILES | CCCOc1ccc(PC(=O)c2c(OC)cccc2OC)c(OCCC)c1 |
| InChI | InChI=1S/C21H27O5P/c1-5-12-25-15-10-11-19(18(14-15)26-13-6-2)27-21(22)20-16(23-3)8-7-9-17(20)24-4/h7-11,14,27H,5-6,12-13H2,1-4H3 |
| InChIKey | NBKNNZSUBBHMCG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|