C22H28ClO4P — CID 18514382
[2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methoxyphenyl)methanone (PubChem CID 18514382) has the molecular formula C22H28ClO4P and a molecular weight of 422.89 g/mol. Its IUPAC name is [2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methoxyphenyl)methanone.
| Compound Name | [2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 18514382 |
| Molecular Formula | C22H28ClO4P |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [2,4-bis(2-methylpropoxy)phenyl]phosphanyl-(2-chloro-6-methoxyphenyl)methanone |
| SMILES | COc1cccc(Cl)c1C(=O)Pc1ccc(OCC(C)C)cc1OCC(C)C |
| InChI | InChI=1S/C22H28ClO4P/c1-14(2)12-26-16-9-10-20(19(11-16)27-13-15(3)4)28-22(24)21-17(23)7-6-8-18(21)25-5/h6-11,14-15,28H,12-13H2,1-5H3 |
| InChIKey | KGEBVJANHFXKFR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|