C26H36ClLiO5P+ — CID 18515183
lithium (2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone (PubChem CID 18515183) has the molecular formula C26H36ClLiO5P+ and a molecular weight of 501.94 g/mol. Its IUPAC name is lithium (2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone.
| Compound Name | lithium (2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18515183 |
| Molecular Formula | C26H36ClLiO5P+ |
| Molecular Weight | 501.94 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | lithium (2-chloro-6-methoxyphenyl)-[2,4,6-tris(2-methylpropoxy)phenyl]phosphanylmethanone |
| SMILES | COc1cccc(Cl)c1C(=O)Pc1c(OCC(C)C)cc(OCC(C)C)cc1OCC(C)C.[Li+] |
| InChI | InChI=1S/C26H36ClO5P.Li/c1-16(2)13-30-19-11-22(31-14-17(3)4)25(23(12-19)32-15-18(5)6)33-26(28)24-20(27)9-8-10-21(24)29-7;/h8-12,16-18,33H,13-15H2,1-7H3;/q;+1 |
| InChIKey | OQFRSWBYVVPPDB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|