C26H36ClO5P — CID 22460050
(2-chloro-6-methoxyphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone (PubChem CID 22460050) has the molecular formula C26H36ClO5P and a molecular weight of 495.00 g/mol. Its IUPAC name is (2-chloro-6-methoxyphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone.
| Compound Name | (2-chloro-6-methoxyphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 22460050 |
| Molecular Formula | C26H36ClO5P |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | (2-chloro-6-methoxyphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone |
| SMILES | CCC(C)Oc1cc(OC(C)CC)c(PC(=O)c2c(Cl)cccc2OC)c(OC(C)CC)c1 |
| InChI | InChI=1S/C26H36ClO5P/c1-8-16(4)30-19-14-22(31-17(5)9-2)25(23(15-19)32-18(6)10-3)33-26(28)24-20(27)12-11-13-21(24)29-7/h11-18,33H,8-10H2,1-7H3 |
| InChIKey | YWPMPJKHLHIGJC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|