C29H43O4P — CID 18515217
(2,3,4,6-tetramethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone (PubChem CID 18515217) has the molecular formula C29H43O4P and a molecular weight of 486.63 g/mol. Its IUPAC name is (2,3,4,6-tetramethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone.
| Compound Name | (2,3,4,6-tetramethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18515217 |
| Molecular Formula | C29H43O4P |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | (2,3,4,6-tetramethylphenyl)-[2,4,6-tri(butan-2-yloxy)phenyl]phosphanylmethanone |
| SMILES | CCC(C)Oc1cc(OC(C)CC)c(PC(=O)c2c(C)cc(C)c(C)c2C)c(OC(C)CC)c1 |
| InChI | InChI=1S/C29H43O4P/c1-11-19(6)31-24-15-25(32-20(7)12-2)28(26(16-24)33-21(8)13-3)34-29(30)27-18(5)14-17(4)22(9)23(27)10/h14-16,19-21,34H,11-13H2,1-10H3 |
| InChIKey | IQWZUEGBNMJRPW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|