C28H41LiO7P+ — CID 22460046
lithium (4-tert-butyl-2,6-dimethylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone (PubChem CID 22460046) has the molecular formula C28H41LiO7P+ and a molecular weight of 527.54 g/mol. Its IUPAC name is lithium (4-tert-butyl-2,6-dimethylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone.
| Compound Name | lithium (4-tert-butyl-2,6-dimethylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 22460046 |
| Molecular Formula | C28H41LiO7P+ |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | lithium (4-tert-butyl-2,6-dimethylphenyl)-[2,4,6-tris(1-methoxyethoxy)phenyl]phosphanylmethanone |
| SMILES | COC(C)Oc1cc(OC(C)OC)c(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)c(OC(C)OC)c1.[Li+] |
| InChI | InChI=1S/C28H41O7P.Li/c1-16-12-21(28(6,7)8)13-17(2)25(16)27(29)36-26-23(34-19(4)31-10)14-22(33-18(3)30-9)15-24(26)35-20(5)32-11;/h12-15,18-20,36H,1-11H3;/q;+1 |
| InChIKey | IOAKRYAFZSTRSG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|