C37H60LiO4P — CID 173245452
lithium;(4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-trihexoxyphenyl)phosphanylmethanone;hydride (PubChem CID 173245452) has the molecular formula C37H60LiO4P and a molecular weight of 606.80 g/mol. Its IUPAC name is lithium;(4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-trihexoxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;(4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-trihexoxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245452 |
| Molecular Formula | C37H60LiO4P |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.44 |
| IUPAC Name | lithium;(4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-trihexoxyphenyl)phosphanylmethanone;hydride |
| SMILES | CCCCCCOc1cc(OCCCCCC)c(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)c(OCCCCCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C37H59O4P.Li.H/c1-9-12-15-18-21-39-31-26-32(40-22-19-16-13-10-2)35(33(27-31)41-23-20-17-14-11-3)42-36(38)34-28(4)24-30(25-29(34)5)37(6,7)8;;/h24-27,42H,9-23H2,1-8H3;;/q;+1;-1 |
| InChIKey | AXLUFRKDXUBCSC-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|