C24H28F6LiO4P — CID 173243882
lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4,6-tripropoxyphenyl)phosphanylmethanone;hydride (PubChem CID 173243882) has the molecular formula C24H28F6LiO4P and a molecular weight of 532.39 g/mol. Its IUPAC name is lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4,6-tripropoxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4,6-tripropoxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173243882 |
| Molecular Formula | C24H28F6LiO4P |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4,6-tripropoxyphenyl)phosphanylmethanone;hydride |
| SMILES | CCCOc1cc(OCCC)c(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c(OCCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C24H27F6O4P.Li.H/c1-4-10-32-15-13-18(33-11-5-2)21(19(14-15)34-12-6-3)35-22(31)20-16(23(25,26)27)8-7-9-17(20)24(28,29)30;;/h7-9,13-14,35H,4-6,10-12H2,1-3H3;;/q;+1;-1 |
| InChIKey | WAANDRMCURUYBB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|