C17H14F6LiO3P — CID 173244361
lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4-dimethoxyphenyl)phosphanylmethanone;hydride (PubChem CID 173244361) has the molecular formula C17H14F6LiO3P and a molecular weight of 418.20 g/mol. Its IUPAC name is lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4-dimethoxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4-dimethoxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244361 |
| Molecular Formula | C17H14F6LiO3P |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | lithium;[2,6-bis(trifluoromethyl)phenyl]-(2,4-dimethoxyphenyl)phosphanylmethanone;hydride |
| SMILES | COc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c(OC)c1.[H-].[Li+] |
| InChI | InChI=1S/C17H13F6O3P.Li.H/c1-25-9-6-7-13(12(8-9)26-2)27-15(24)14-10(16(18,19)20)4-3-5-11(14)17(21,22)23;;/h3-8,27H,1-2H3;;/q;+1;-1 |
| InChIKey | SGIRMDWECHTFGQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|