About [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone
[2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone (PubChem CID 173244485) has the molecular formula C19H17F6O3P
and a molecular weight of 438.30 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone.
Molecular Properties
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone |
| PubChem CID | 173244485 |
| Molecular Formula | C19H17F6O3P |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone |
| SMILES | COC(C)Oc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C19H17F6O3P/c1-10-9-12(28-11(2)27-3)7-8-15(10)29-17(26)16-13(18(20,21)22)5-4-6-14(16)19(23,24)25/h4-9,11,29H,1-3H3 |
| InChIKey | UAIWJDUFEUFQCA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone?
The IUPAC name of [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone (CID 173244485) is [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone.
What is the SMILES notation for [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone?
The canonical SMILES for [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone is COC(C)Oc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c(C)c1.
What is the InChIKey of [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone?
The InChIKey is UAIWJDUFEUFQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F6O3P/c1-10-9-12(28-11(2)27-3)7-8-15(10)29-17(26)16-13(18(20,21)22)5-4-6-14(16)19(23,24)25/h4-9,11,29H,1-3H3.
What are the key properties of [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone?
[2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone has a molecular weight of 438.30 g/mol, XLogP of 5.55, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(trifluoromethyl)phenyl]-[4-(1-methoxyethoxy)-2-methylphenyl]phosphanylmethanone is sourced from PubChem (CID 173244485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).