C21H27O6P — CID 70016913
[4-(1-ethoxyethoxy)-2-methylphenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 70016913) has the molecular formula C21H27O6P and a molecular weight of 406.42 g/mol. Its IUPAC name is [4-(1-ethoxyethoxy)-2-methylphenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | [4-(1-ethoxyethoxy)-2-methylphenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 70016913 |
| Molecular Formula | C21H27O6P |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [4-(1-ethoxyethoxy)-2-methylphenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | CCOC(C)Oc1ccc(PC(=O)c2c(OC)cc(OC)cc2OC)c(C)c1 |
| InChI | InChI=1S/C21H27O6P/c1-7-26-14(3)27-15-8-9-19(13(2)10-15)28-21(22)20-17(24-5)11-16(23-4)12-18(20)25-6/h8-12,14,28H,7H2,1-6H3 |
| InChIKey | HTRMXMTUUOSYTB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|