C22H30LiO6P — CID 173244539
lithium;(2,4-dipropoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone;hydride (PubChem CID 173244539) has the molecular formula C22H30LiO6P and a molecular weight of 428.39 g/mol. Its IUPAC name is lithium;(2,4-dipropoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone;hydride.
| Compound Name | lithium;(2,4-dipropoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173244539 |
| Molecular Formula | C22H30LiO6P |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | lithium;(2,4-dipropoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone;hydride |
| SMILES | CCCOc1ccc(PC(=O)c2c(OC)cc(OC)cc2OC)c(OCCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C22H29O6P.Li.H/c1-6-10-27-15-8-9-20(17(12-15)28-11-7-2)29-22(23)21-18(25-4)13-16(24-3)14-19(21)26-5;;/h8-9,12-14,29H,6-7,10-11H2,1-5H3;;/q;+1;-1 |
| InChIKey | FACOYNRXCLLZEM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|