C22H30LiO5P — CID 173244960
lithium;hydride;[2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 173244960) has the molecular formula C22H30LiO5P and a molecular weight of 412.39 g/mol. Its IUPAC name is lithium;hydride;[2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | lithium;hydride;[2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 173244960 |
| Molecular Formula | C22H30LiO5P |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | lithium;hydride;[2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(C(=O)Pc2ccc(OCCC(C)C)cc2C)c(OC)c1.[H-].[Li+] |
| InChI | InChI=1S/C22H29O5P.Li.H/c1-14(2)9-10-27-16-7-8-20(15(3)11-16)28-22(23)21-18(25-5)12-17(24-4)13-19(21)26-6;;/h7-8,11-14,28H,9-10H2,1-6H3;;/q;+1;-1 |
| InChIKey | DROZDMLLFSWDLC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|