C25H29F6O3P — CID 18515186
[2,4-bis(3-methylbutoxy)phenyl]phosphanyl-[2,6-bis(trifluoromethyl)phenyl]methanone (PubChem CID 18515186) has the molecular formula C25H29F6O3P and a molecular weight of 522.47 g/mol. Its IUPAC name is [2,4-bis(3-methylbutoxy)phenyl]phosphanyl-[2,6-bis(trifluoromethyl)phenyl]methanone.
| Compound Name | [2,4-bis(3-methylbutoxy)phenyl]phosphanyl-[2,6-bis(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 18515186 |
| Molecular Formula | C25H29F6O3P |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [2,4-bis(3-methylbutoxy)phenyl]phosphanyl-[2,6-bis(trifluoromethyl)phenyl]methanone |
| SMILES | CC(C)CCOc1ccc(PC(=O)c2c(C(F)(F)F)cccc2C(F)(F)F)c(OCCC(C)C)c1 |
| InChI | InChI=1S/C25H29F6O3P/c1-15(2)10-12-33-17-8-9-21(20(14-17)34-13-11-16(3)4)35-23(32)22-18(24(26,27)28)6-5-7-19(22)25(29,30)31/h5-9,14-16,35H,10-13H2,1-4H3 |
| InChIKey | VEGNHTRFYVPABF-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|