C25H35O5P — CID 70015718
[2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone (PubChem CID 70015718) has the molecular formula C25H35O5P and a molecular weight of 446.52 g/mol. Its IUPAC name is [2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone.
| Compound Name | [2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 70015718 |
| Molecular Formula | C25H35O5P |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(4-tert-butyl-2,6-dimethylphenyl)methanone |
| SMILES | COCCOc1ccc(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)c(OCCOC)c1 |
| InChI | InChI=1S/C25H35O5P/c1-17-14-19(25(3,4)5)15-18(2)23(17)24(26)31-22-9-8-20(29-12-10-27-6)16-21(22)30-13-11-28-7/h8-9,14-16,31H,10-13H2,1-7H3 |
| InChIKey | KDCOVBVPRUZERE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|