C28H41O4P — CID 18514442
(4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripropoxyphenyl)phosphanylmethanone (PubChem CID 18514442) has the molecular formula C28H41O4P and a molecular weight of 472.61 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripropoxyphenyl)phosphanylmethanone.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripropoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514442 |
| Molecular Formula | C28H41O4P |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)-(2,4,6-tripropoxyphenyl)phosphanylmethanone |
| SMILES | CCCOc1cc(OCCC)c(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)c(OCCC)c1 |
| InChI | InChI=1S/C28H41O4P/c1-9-12-30-22-17-23(31-13-10-2)26(24(18-22)32-14-11-3)33-27(29)25-19(4)15-21(16-20(25)5)28(6,7)8/h15-18,33H,9-14H2,1-8H3 |
| InChIKey | YJMXUCWEKZJXSF-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|