C24H34LiO7P — CID 173244643
lithium;(2,6-dimethylphenyl)-[2,4,6-tris(2-methoxyethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173244643) has the molecular formula C24H34LiO7P and a molecular weight of 472.44 g/mol. Its IUPAC name is lithium;(2,6-dimethylphenyl)-[2,4,6-tris(2-methoxyethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethylphenyl)-[2,4,6-tris(2-methoxyethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244643 |
| Molecular Formula | C24H34LiO7P |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | lithium;(2,6-dimethylphenyl)-[2,4,6-tris(2-methoxyethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | COCCOc1cc(OCCOC)c(PC(=O)c2c(C)cccc2C)c(OCCOC)c1.[H-].[Li+] |
| InChI | InChI=1S/C24H33O7P.Li.H/c1-17-7-6-8-18(2)22(17)24(25)32-23-20(30-13-10-27-4)15-19(29-12-9-26-3)16-21(23)31-14-11-28-5;;/h6-8,15-16,32H,9-14H2,1-5H3;;/q;+1;-1 |
| InChIKey | PTLVBCBIRKRPBB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|