C31H48LiO4P — CID 173244414
lithium;hydride;(2,4,6-trimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone (PubChem CID 173244414) has the molecular formula C31H48LiO4P and a molecular weight of 522.64 g/mol. Its IUPAC name is lithium;hydride;(2,4,6-trimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone.
| Compound Name | lithium;hydride;(2,4,6-trimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 173244414 |
| Molecular Formula | C31H48LiO4P |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | lithium;hydride;(2,4,6-trimethylphenyl)-(2,4,6-tripentoxyphenyl)phosphanylmethanone |
| SMILES | CCCCCOc1cc(OCCCCC)c(PC(=O)c2c(C)cc(C)cc2C)c(OCCCCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C31H47O4P.Li.H/c1-7-10-13-16-33-26-21-27(34-17-14-11-8-2)30(28(22-26)35-18-15-12-9-3)36-31(32)29-24(5)19-23(4)20-25(29)6;;/h19-22,36H,7-18H2,1-6H3;;/q;+1;-1 |
| InChIKey | XPUBVBYKFGOKQE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|