C21H27LiO2P+ — CID 18514482
lithium (4-pentoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 18514482) has the molecular formula C21H27LiO2P+ and a molecular weight of 349.36 g/mol. Its IUPAC name is lithium (4-pentoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | lithium (4-pentoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 18514482 |
| Molecular Formula | C21H27LiO2P+ |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | lithium (4-pentoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCCOc1ccc(PC(=O)c2c(C)cc(C)cc2C)cc1.[Li+] |
| InChI | InChI=1S/C21H27O2P.Li/c1-5-6-7-12-23-18-8-10-19(11-9-18)24-21(22)20-16(3)13-15(2)14-17(20)4;/h8-11,13-14,24H,5-7,12H2,1-4H3;/q;+1 |
| InChIKey | LQPXANKAAWVNBI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|