C19H24LiO2P — CID 173245275
lithium;(4-butoxyphenyl)phosphanyl-(2,6-dimethylphenyl)methanone;hydride (PubChem CID 173245275) has the molecular formula C19H24LiO2P and a molecular weight of 322.31 g/mol. Its IUPAC name is lithium;(4-butoxyphenyl)phosphanyl-(2,6-dimethylphenyl)methanone;hydride.
| Compound Name | lithium;(4-butoxyphenyl)phosphanyl-(2,6-dimethylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173245275 |
| Molecular Formula | C19H24LiO2P |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | lithium;(4-butoxyphenyl)phosphanyl-(2,6-dimethylphenyl)methanone;hydride |
| SMILES | CCCCOc1ccc(PC(=O)c2c(C)cccc2C)cc1.[H-].[Li+] |
| InChI | InChI=1S/C19H23O2P.Li.H/c1-4-5-13-21-16-9-11-17(12-10-16)22-19(20)18-14(2)7-6-8-15(18)3;;/h6-12,22H,4-5,13H2,1-3H3;;/q;+1;-1 |
| InChIKey | IQNNAQPSCQLPCV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|