C16H17LiOP+ — CID 18513809
lithium (2,6-dimethylphenyl)-(4-methylphenyl)phosphanylmethanone (PubChem CID 18513809) has the molecular formula C16H17LiOP+ and a molecular weight of 263.23 g/mol. Its IUPAC name is lithium (2,6-dimethylphenyl)-(4-methylphenyl)phosphanylmethanone.
| Compound Name | lithium (2,6-dimethylphenyl)-(4-methylphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18513809 |
| Molecular Formula | C16H17LiOP+ |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | lithium (2,6-dimethylphenyl)-(4-methylphenyl)phosphanylmethanone |
| SMILES | Cc1ccc(PC(=O)c2c(C)cccc2C)cc1.[Li+] |
| InChI | InChI=1S/C16H17OP.Li/c1-11-7-9-14(10-8-11)18-16(17)15-12(2)5-4-6-13(15)3;/h4-10,18H,1-3H3;/q;+1 |
| InChIKey | HZKWLDIMPRCJQY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|