C25H28LiOP — CID 173245629
lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-phenylphenyl)phosphanylmethanone;hydride (PubChem CID 173245629) has the molecular formula C25H28LiOP and a molecular weight of 382.41 g/mol. Its IUPAC name is lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-phenylphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-phenylphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245629 |
| Molecular Formula | C25H28LiOP |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | lithium;(4-tert-butyl-2,6-dimethylphenyl)-(4-phenylphenyl)phosphanylmethanone;hydride |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)Pc1ccc(-c2ccccc2)cc1.[H-].[Li+] |
| InChI | InChI=1S/C25H27OP.Li.H/c1-17-15-21(25(3,4)5)16-18(2)23(17)24(26)27-22-13-11-20(12-14-22)19-9-7-6-8-10-19;;/h6-16,27H,1-5H3;;/q;+1;-1 |
| InChIKey | SLWJRFPHLOQHPL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|