C16H18LiO3P — CID 173244321
lithium;(2,6-dimethoxy-4-methylphenyl)-phenylphosphanylmethanone;hydride (PubChem CID 173244321) has the molecular formula C16H18LiO3P and a molecular weight of 296.23 g/mol. Its IUPAC name is lithium;(2,6-dimethoxy-4-methylphenyl)-phenylphosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethoxy-4-methylphenyl)-phenylphosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244321 |
| Molecular Formula | C16H18LiO3P |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | lithium;(2,6-dimethoxy-4-methylphenyl)-phenylphosphanylmethanone;hydride |
| SMILES | COc1cc(C)cc(OC)c1C(=O)Pc1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C16H17O3P.Li.H/c1-11-9-13(18-2)15(14(10-11)19-3)16(17)20-12-7-5-4-6-8-12;;/h4-10,20H,1-3H3;;/q;+1;-1 |
| InChIKey | OTSZDXDPZJQNEH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|