C17H19LiO5P+ — CID 18514847
lithium (4-methoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 18514847) has the molecular formula C17H19LiO5P+ and a molecular weight of 341.25 g/mol. Its IUPAC name is lithium (4-methoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | lithium (4-methoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18514847 |
| Molecular Formula | C17H19LiO5P+ |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | lithium (4-methoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(PC(=O)c2c(OC)cc(OC)cc2OC)cc1.[Li+] |
| InChI | InChI=1S/C17H19O5P.Li/c1-19-11-5-7-13(8-6-11)23-17(18)16-14(21-3)9-12(20-2)10-15(16)22-4;/h5-10,23H,1-4H3;/q;+1 |
| InChIKey | RTLFOIDZIBXJBO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|