C18H21LiO6P+ — CID 18514898
lithium (2,6-dimethoxyphenyl)-(2,4,6-trimethoxyphenyl)phosphanylmethanone (PubChem CID 18514898) has the molecular formula C18H21LiO6P+ and a molecular weight of 371.28 g/mol. Its IUPAC name is lithium (2,6-dimethoxyphenyl)-(2,4,6-trimethoxyphenyl)phosphanylmethanone.
| Compound Name | lithium (2,6-dimethoxyphenyl)-(2,4,6-trimethoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514898 |
| Molecular Formula | C18H21LiO6P+ |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | lithium (2,6-dimethoxyphenyl)-(2,4,6-trimethoxyphenyl)phosphanylmethanone |
| SMILES | COc1cc(OC)c(PC(=O)c2c(OC)cccc2OC)c(OC)c1.[Li+] |
| InChI | InChI=1S/C18H21O6P.Li/c1-20-11-9-14(23-4)17(15(10-11)24-5)25-18(19)16-12(21-2)7-6-8-13(16)22-3;/h6-10,25H,1-5H3;/q;+1 |
| InChIKey | VBGRBWSVIAWTCS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|