C17H19LiO3P+ — CID 18514916
lithium (2,6-dimethoxyphenyl)-(2,6-dimethylphenyl)phosphanylmethanone (PubChem CID 18514916) has the molecular formula C17H19LiO3P+ and a molecular weight of 309.25 g/mol. Its IUPAC name is lithium (2,6-dimethoxyphenyl)-(2,6-dimethylphenyl)phosphanylmethanone.
| Compound Name | lithium (2,6-dimethoxyphenyl)-(2,6-dimethylphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514916 |
| Molecular Formula | C17H19LiO3P+ |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | lithium (2,6-dimethoxyphenyl)-(2,6-dimethylphenyl)phosphanylmethanone |
| SMILES | COc1cccc(OC)c1C(=O)Pc1c(C)cccc1C.[Li+] |
| InChI | InChI=1S/C17H19O3P.Li/c1-11-7-5-8-12(2)16(11)21-17(18)15-13(19-3)9-6-10-14(15)20-4;/h5-10,21H,1-4H3;/q;+1 |
| InChIKey | VUHGWCBRGKOGIT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|