C17H18ClLiO4P — CID 70014966
CID 70014966 (PubChem CID 70014966) has the molecular formula C17H18ClLiO4P and a molecular weight of 359.70 g/mol.
| Compound Name | CID 70014966 |
|---|---|
| PubChem CID | 70014966 |
| Molecular Formula | C17H18ClLiO4P |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | — |
| SMILES | COc1cc(OC)c(PC(=O)c2c(C)cccc2Cl)c(OC)c1.[Li] |
| InChI | InChI=1S/C17H18ClO4P.Li/c1-10-6-5-7-12(18)15(10)17(19)23-16-13(21-3)8-11(20-2)9-14(16)22-4;/h5-9,23H,1-4H3; |
| InChIKey | PMWBUYKLFBXEMX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|