C27H39O4P — CID 18514070
(2,6-dimethylphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone (PubChem CID 18514070) has the molecular formula C27H39O4P and a molecular weight of 458.58 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone.
| Compound Name | (2,6-dimethylphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18514070 |
| Molecular Formula | C27H39O4P |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (2,6-dimethylphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone |
| SMILES | Cc1cccc(C)c1C(=O)Pc1c(OC(C)(C)C)cc(OC(C)(C)C)cc1OC(C)(C)C |
| InChI | InChI=1S/C27H39O4P/c1-17-13-12-14-18(2)22(17)24(28)32-23-20(30-26(6,7)8)15-19(29-25(3,4)5)16-21(23)31-27(9,10)11/h12-16,32H,1-11H3 |
| InChIKey | UBODQYXMISURAP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|