C21H27LiO4P — CID 70015738
CID 70015738 (PubChem CID 70015738) has the molecular formula C21H27LiO4P and a molecular weight of 381.36 g/mol.
| Compound Name | CID 70015738 |
|---|---|
| PubChem CID | 70015738 |
| Molecular Formula | C21H27LiO4P |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | — |
| SMILES | CCOc1cc(OCC)c(PC(=O)c2c(C)cccc2C)c(OCC)c1.[Li] |
| InChI | InChI=1S/C21H27O4P.Li/c1-6-23-16-12-17(24-7-2)20(18(13-16)25-8-3)26-21(22)19-14(4)10-9-11-15(19)5;/h9-13,26H,6-8H2,1-5H3; |
| InChIKey | WRFKEUPEUAQSEE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|